C25H26N8 — CID 24872011
3-[4-(1H-indol-3-ylmethyl)piperazin-1-yl]-5-(3-methyl-2H-indazol-5-yl)pyrazin-2-amine (PubChem CID 24872011) has the molecular formula C25H26N8 and a molecular weight of 438.54 g/mol. Its IUPAC name is 3-[4-(1H-indol-3-ylmethyl)piperazin-1-yl]-5-(3-methyl-2H-indazol-5-yl)pyrazin-2-amine.
| Compound Name | 3-[4-(1H-indol-3-ylmethyl)piperazin-1-yl]-5-(3-methyl-2H-indazol-5-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 24872011 |
| Molecular Formula | C25H26N8 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 3-[4-(1H-indol-3-ylmethyl)piperazin-1-yl]-5-(3-methyl-2H-indazol-5-yl)pyrazin-2-amine |
| SMILES | Cc1[nH]nc2ccc(-c3cnc(N)c(N4CCN(Cc5c[nH]c6ccccc56)CC4)n3)cc12 |
| InChI | InChI=1S/C25H26N8/c1-16-20-12-17(6-7-22(20)31-30-16)23-14-28-24(26)25(29-23)33-10-8-32(9-11-33)15-18-13-27-21-5-3-2-4-19(18)21/h2-7,12-14,27H,8-11,15H2,1H3,(H2,26,28)(H,30,31) |
| InChIKey | OSDSSWSLYXXJIH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |