C18H21NO2 — CID 24873613
(3R,7aS,11aS)-8-methyl-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-one (PubChem CID 24873613) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3R,7aS,11aS)-8-methyl-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-one.
| Compound Name | (3R,7aS,11aS)-8-methyl-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-one |
|---|---|
| PubChem CID | 24873613 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3R,7aS,11aS)-8-methyl-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-one |
| SMILES | CC1=CCC[C@@]23OC[C@@H](c4ccccc4)N2C(=O)CC[C@@H]13 |
| InChI | InChI=1S/C18H21NO2/c1-13-6-5-11-18-15(13)9-10-17(20)19(18)16(12-21-18)14-7-3-2-4-8-14/h2-4,6-8,15-16H,5,9-12H2,1H3/t15-,16-,18-/m0/s1 |
| InChIKey | BMOHFCKINYYSBM-BQFCYCMXSA-N |
| XLogP | 3.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|