C23H33N5O3 — CID 24874113
(2S,4S)-4-[[(2S)-2,6-diaminohexanoyl]amino]-1-[(4-methoxynaphthalen-1-yl)methyl]pyrrolidine-2-carboxamide (PubChem CID 24874113) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S,4S)-4-[[(2S)-2,6-diaminohexanoyl]amino]-1-[(4-methoxynaphthalen-1-yl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-[[(2S)-2,6-diaminohexanoyl]amino]-1-[(4-methoxynaphthalen-1-yl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24874113 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (2S,4S)-4-[[(2S)-2,6-diaminohexanoyl]amino]-1-[(4-methoxynaphthalen-1-yl)methyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(CN2C[C@@H](NC(=O)[C@@H](N)CCCCN)C[C@H]2C(N)=O)c2ccccc12 |
| InChI | InChI=1S/C23H33N5O3/c1-31-21-10-9-15(17-6-2-3-7-18(17)21)13-28-14-16(12-20(28)22(26)29)27-23(30)19(25)8-4-5-11-24/h2-3,6-7,9-10,16,19-20H,4-5,8,11-14,24-25H2,1H3,(H2,26,29)(H,27,30)/t16-,19-,20-/m0/s1 |
| InChIKey | PAOGGYVEDSHEHX-VDGAXYAQSA-N |
| XLogP | 0.85 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|