C25H31NOS — CID 24874368
(E)-1-phenyl-3-[4-(5-piperidin-1-ylpentylsulfanyl)phenyl]prop-2-en-1-one (PubChem CID 24874368) has the molecular formula C25H31NOS and a molecular weight of 393.60 g/mol. Its IUPAC name is (E)-1-phenyl-3-[4-(5-piperidin-1-ylpentylsulfanyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-phenyl-3-[4-(5-piperidin-1-ylpentylsulfanyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 24874368 |
| Molecular Formula | C25H31NOS |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (E)-1-phenyl-3-[4-(5-piperidin-1-ylpentylsulfanyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(SCCCCCN2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H31NOS/c27-25(23-10-4-1-5-11-23)17-14-22-12-15-24(16-13-22)28-21-9-3-8-20-26-18-6-2-7-19-26/h1,4-5,10-17H,2-3,6-9,18-21H2/b17-14+ |
| InChIKey | IVSMURHPENQJJU-SAPNQHFASA-N |
| XLogP | 6.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|