C20H15N3O2S2 — CID 24877597
3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]sulfanyl]benzoic acid (PubChem CID 24877597) has the molecular formula C20H15N3O2S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]sulfanyl]benzoic acid.
| Compound Name | 3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 24877597 |
| Molecular Formula | C20H15N3O2S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]sulfanyl]benzoic acid |
| SMILES | Cc1c(-c2ccnc(N)n2)sc2ccc(Sc3cccc(C(=O)O)c3)cc12 |
| InChI | InChI=1S/C20H15N3O2S2/c1-11-15-10-14(26-13-4-2-3-12(9-13)19(24)25)5-6-17(15)27-18(11)16-7-8-22-20(21)23-16/h2-10H,1H3,(H,24,25)(H2,21,22,23) |
| InChIKey | QIELAHDLNQFCES-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |