C24H23N3O2S — CID 24878619
propan-2-yl 3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]methyl]benzoate (PubChem CID 24878619) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is propan-2-yl 3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]methyl]benzoate.
| Compound Name | propan-2-yl 3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]methyl]benzoate |
|---|---|
| PubChem CID | 24878619 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | propan-2-yl 3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]methyl]benzoate |
| SMILES | Cc1c(-c2ccnc(N)n2)sc2ccc(Cc3cccc(C(=O)OC(C)C)c3)cc12 |
| InChI | InChI=1S/C24H23N3O2S/c1-14(2)29-23(28)18-6-4-5-16(12-18)11-17-7-8-21-19(13-17)15(3)22(30-21)20-9-10-26-24(25)27-20/h4-10,12-14H,11H2,1-3H3,(H2,25,26,27) |
| InChIKey | LOPLFYHUFDUJIE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |