C28H28N2O4S — CID 24878035
2-[3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-4-(2-phenylethynyl)phenyl]acetic acid (PubChem CID 24878035) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-[3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-4-(2-phenylethynyl)phenyl]acetic acid.
| Compound Name | 2-[3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-4-(2-phenylethynyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 24878035 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-[3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-4-(2-phenylethynyl)phenyl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(Cc3cc(CC(=O)O)ccc3C#Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H28N2O4S/c1-22-7-13-27(14-8-22)35(33,34)30-17-15-29(16-18-30)21-26-19-24(20-28(31)32)10-12-25(26)11-9-23-5-3-2-4-6-23/h2-8,10,12-14,19H,15-18,20-21H2,1H3,(H,31,32) |
| InChIKey | GIGWGQNFWUUMCN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|