C24H24FNO4S — CID 71603976
2-[6-fluoro-4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]naphthalen-2-yl]acetic acid (PubChem CID 71603976) has the molecular formula C24H24FNO4S and a molecular weight of 441.52 g/mol. Its IUPAC name is 2-[6-fluoro-4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-fluoro-4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71603976 |
| Molecular Formula | C24H24FNO4S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-[6-fluoro-4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]naphthalen-2-yl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3cc(CC(=O)O)cc4ccc(F)cc34)CC2)cc1 |
| InChI | InChI=1S/C24H24FNO4S/c1-16-2-6-21(7-3-16)31(29,30)26-10-8-18(9-11-26)22-13-17(14-24(27)28)12-19-4-5-20(25)15-23(19)22/h2-7,12-13,15,18H,8-11,14H2,1H3,(H,27,28) |
| InChIKey | BMFNCADIGSOVGK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |