C24H24ClNO4S — CID 71711380
2-[6-chloro-3-methyl-4-(4-piperidin-1-ylsulfonylphenyl)naphthalen-2-yl]acetic acid (PubChem CID 71711380) has the molecular formula C24H24ClNO4S and a molecular weight of 457.98 g/mol. Its IUPAC name is 2-[6-chloro-3-methyl-4-(4-piperidin-1-ylsulfonylphenyl)naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-chloro-3-methyl-4-(4-piperidin-1-ylsulfonylphenyl)naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71711380 |
| Molecular Formula | C24H24ClNO4S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-[6-chloro-3-methyl-4-(4-piperidin-1-ylsulfonylphenyl)naphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(Cl)cc2c1-c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H24ClNO4S/c1-16-19(14-23(27)28)13-18-5-8-20(25)15-22(18)24(16)17-6-9-21(10-7-17)31(29,30)26-11-3-2-4-12-26/h5-10,13,15H,2-4,11-12,14H2,1H3,(H,27,28) |
| InChIKey | AUUFENDKQYKJBW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |