C23H22ClNO4S — CID 71680626
2-[6-chloro-3-methyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)naphthalen-2-yl]acetic acid (PubChem CID 71680626) has the molecular formula C23H22ClNO4S and a molecular weight of 443.95 g/mol. Its IUPAC name is 2-[6-chloro-3-methyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-chloro-3-methyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71680626 |
| Molecular Formula | C23H22ClNO4S |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-[6-chloro-3-methyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)naphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(Cl)cc2c1-c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H22ClNO4S/c1-15-18(13-22(26)27)12-17-4-7-19(24)14-21(17)23(15)16-5-8-20(9-6-16)30(28,29)25-10-2-3-11-25/h4-9,12,14H,2-3,10-11,13H2,1H3,(H,26,27) |
| InChIKey | PQLNRVQDMVECQP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |