C23H22ClNO5S — CID 71711572
2-[6-chloro-3-methyl-4-(4-morpholin-4-ylsulfonylphenyl)naphthalen-2-yl]acetic acid (PubChem CID 71711572) has the molecular formula C23H22ClNO5S and a molecular weight of 459.95 g/mol. Its IUPAC name is 2-[6-chloro-3-methyl-4-(4-morpholin-4-ylsulfonylphenyl)naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-chloro-3-methyl-4-(4-morpholin-4-ylsulfonylphenyl)naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71711572 |
| Molecular Formula | C23H22ClNO5S |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 2-[6-chloro-3-methyl-4-(4-morpholin-4-ylsulfonylphenyl)naphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(Cl)cc2c1-c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H22ClNO5S/c1-15-18(13-22(26)27)12-17-2-5-19(24)14-21(17)23(15)16-3-6-20(7-4-16)31(28,29)25-8-10-30-11-9-25/h2-7,12,14H,8-11,13H2,1H3,(H,26,27) |
| InChIKey | NXKKMKFXDGFXEV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |