C33H32N4O4S — CID 24878323
N-[4-[3-[(3,4-diethylphenyl)methyl]-1-methyl-8-nitro-2-oxo-3H-1,4-benzodiazepin-5-yl]phenyl]-2-thiophen-2-ylacetamide (PubChem CID 24878323) has the molecular formula C33H32N4O4S and a molecular weight of 580.71 g/mol. Its IUPAC name is N-[4-[3-[(3,4-diethylphenyl)methyl]-1-methyl-8-nitro-2-oxo-3H-1,4-benzodiazepin-5-yl]phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[3-[(3,4-diethylphenyl)methyl]-1-methyl-8-nitro-2-oxo-3H-1,4-benzodiazepin-5-yl]phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 24878323 |
| Molecular Formula | C33H32N4O4S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | N-[4-[3-[(3,4-diethylphenyl)methyl]-1-methyl-8-nitro-2-oxo-3H-1,4-benzodiazepin-5-yl]phenyl]-2-thiophen-2-ylacetamide |
| SMILES | CCc1ccc(CC2N=C(c3ccc(NC(=O)Cc4cccs4)cc3)c3ccc([N+](=O)[O-])cc3N(C)C2=O)cc1CC |
| InChI | InChI=1S/C33H32N4O4S/c1-4-22-9-8-21(17-23(22)5-2)18-29-33(39)36(3)30-19-26(37(40)41)14-15-28(30)32(35-29)24-10-12-25(13-11-24)34-31(38)20-27-7-6-16-42-27/h6-17,19,29H,4-5,18,20H2,1-3H3,(H,34,38) |
| InChIKey | KOFSHATUJNQJKE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|