C27H26N2O4 — CID 158830761
3-[(3,4-diethylphenyl)methyl]-1-(4-hydroxyphenyl)-8-nitro-3,5-dihydro-2-benzazepin-4-one (PubChem CID 158830761) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[(3,4-diethylphenyl)methyl]-1-(4-hydroxyphenyl)-8-nitro-3,5-dihydro-2-benzazepin-4-one.
| Compound Name | 3-[(3,4-diethylphenyl)methyl]-1-(4-hydroxyphenyl)-8-nitro-3,5-dihydro-2-benzazepin-4-one |
|---|---|
| PubChem CID | 158830761 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-[(3,4-diethylphenyl)methyl]-1-(4-hydroxyphenyl)-8-nitro-3,5-dihydro-2-benzazepin-4-one |
| SMILES | CCc1ccc(CC2N=C(c3ccc(O)cc3)c3cc([N+](=O)[O-])ccc3CC2=O)cc1CC |
| InChI | InChI=1S/C27H26N2O4/c1-3-18-6-5-17(13-19(18)4-2)14-25-26(31)15-21-7-10-22(29(32)33)16-24(21)27(28-25)20-8-11-23(30)12-9-20/h5-13,16,25,30H,3-4,14-15H2,1-2H3 |
| InChIKey | UKEXXGOQJKUJBW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 92.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|