2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid

C12H12N2O3 — CID 24878722

IUPAC2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid
SMILESCc1ccc(Cc2noc(CC(=O)O)n2)cc1
InChIInChI=1S/C12H12N2O3/c1-8-2-4-9(5-3-8)6-10-13-11(17-14-10)7-12(15)16/h2-5H,6-7H2,1H3,(H,15,16)
InChIKeyZHIYTQTZXXUKBL-UHFFFAOYSA-N
MW232.24 g/mol
LogP1.60
Rot. Bonds4

About 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid

2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid (PubChem CID 24878722) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid.

Molecular Properties

Compound Name2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid
PubChem CID24878722
Molecular FormulaC12H12N2O3
Molecular Weight232.24 g/mol
Exact Mass232.08
IUPAC Name2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid
SMILESCc1ccc(Cc2noc(CC(=O)O)n2)cc1
InChIInChI=1S/C12H12N2O3/c1-8-2-4-9(5-3-8)6-10-13-11(17-14-10)7-12(15)16/h2-5H,6-7H2,1H3,(H,15,16)
InChIKeyZHIYTQTZXXUKBL-UHFFFAOYSA-N
XLogP1.60
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 51.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid?
The IUPAC name of 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid (CID 24878722) is 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid?
The canonical SMILES for 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid is Cc1ccc(Cc2noc(CC(=O)O)n2)cc1.
What is the InChIKey of 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid?
The InChIKey is ZHIYTQTZXXUKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-8-2-4-9(5-3-8)6-10-13-11(17-14-10)7-12(15)16/h2-5H,6-7H2,1H3,(H,15,16).
What are the key properties of 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid?
2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid has a molecular weight of 232.24 g/mol, XLogP of 1.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(4-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]acetic acid is sourced from PubChem (CID 24878722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).