C12H20F6N4O4 — CID 24879369
1-(2-aminoethyl)-2-(3-methylbut-2-enyl)guanidine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 24879369) has the molecular formula C12H20F6N4O4 and a molecular weight of 398.30 g/mol. Its IUPAC name is 1-(2-aminoethyl)-2-(3-methylbut-2-enyl)guanidine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-(2-aminoethyl)-2-(3-methylbut-2-enyl)guanidine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 24879369 |
| Molecular Formula | C12H20F6N4O4 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-(2-aminoethyl)-2-(3-methylbut-2-enyl)guanidine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)=CC/N=C(\N)NCCN.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H18N4.2C2HF3O2/c1-7(2)3-5-11-8(10)12-6-4-9;2*3-2(4,5)1(6)7/h3H,4-6,9H2,1-2H3,(H3,10,11,12);2*(H,6,7) |
| InChIKey | PJPPRIICAJMMNE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|