C13H22F6N4O4 — CID 24879371
1-(3-aminopropyl)-2-(3-methylbut-2-enyl)guanidine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 24879371) has the molecular formula C13H22F6N4O4 and a molecular weight of 412.33 g/mol. Its IUPAC name is 1-(3-aminopropyl)-2-(3-methylbut-2-enyl)guanidine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-(3-aminopropyl)-2-(3-methylbut-2-enyl)guanidine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 24879371 |
| Molecular Formula | C13H22F6N4O4 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-(3-aminopropyl)-2-(3-methylbut-2-enyl)guanidine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)=CC/N=C(\N)NCCCN.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H20N4.2C2HF3O2/c1-8(2)4-7-13-9(11)12-6-3-5-10;2*3-2(4,5)1(6)7/h4H,3,5-7,10H2,1-2H3,(H3,11,12,13);2*(H,6,7) |
| InChIKey | OFYUQRZVCFLISI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|