C22H20N4O4 — CID 24879463
6-quinolin-4-yloxy-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine (PubChem CID 24879463) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 6-quinolin-4-yloxy-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine.
| Compound Name | 6-quinolin-4-yloxy-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 24879463 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 6-quinolin-4-yloxy-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine |
| SMILES | COc1cc(Nc2cncc(Oc3ccnc4ccccc34)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H20N4O4/c1-27-18-10-14(11-19(28-2)22(18)29-3)25-20-12-23-13-21(26-20)30-17-8-9-24-16-7-5-4-6-15(16)17/h4-13H,1-3H3,(H,25,26) |
| InChIKey | ZYSUAIQBODJHIO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |