C22H44O2Si — CID 24879566
[(3R,8S,9R)-9-methoxy-8-methylundec-1-yn-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 24879566) has the molecular formula C22H44O2Si and a molecular weight of 368.68 g/mol. Its IUPAC name is [(3R,8S,9R)-9-methoxy-8-methylundec-1-yn-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3R,8S,9R)-9-methoxy-8-methylundec-1-yn-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 24879566 |
| Molecular Formula | C22H44O2Si |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 368.31 |
| IUPAC Name | [(3R,8S,9R)-9-methoxy-8-methylundec-1-yn-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C#C[C@@H](CCCC[C@H](C)[C@@H](CC)OC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H44O2Si/c1-11-21(16-14-13-15-20(9)22(12-2)23-10)24-25(17(3)4,18(5)6)19(7)8/h1,17-22H,12-16H2,2-10H3/t20-,21-,22+/m0/s1 |
| InChIKey | DRFJDAFYOHFFJA-FDFHNCONSA-N |
| XLogP | 6.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|