C15H33NO — CID 163818827
(8R)-3-ethyl-8-methoxy-N,7-dimethyldecan-1-amine (PubChem CID 163818827) has the molecular formula C15H33NO and a molecular weight of 243.43 g/mol. Its IUPAC name is (8R)-3-ethyl-8-methoxy-N,7-dimethyldecan-1-amine.
| Compound Name | (8R)-3-ethyl-8-methoxy-N,7-dimethyldecan-1-amine |
|---|---|
| PubChem CID | 163818827 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | (8R)-3-ethyl-8-methoxy-N,7-dimethyldecan-1-amine |
| SMILES | CCC(CCCC(C)[C@@H](CC)OC)CCNC |
| InChI | InChI=1S/C15H33NO/c1-6-14(11-12-16-4)10-8-9-13(3)15(7-2)17-5/h13-16H,6-12H2,1-5H3/t13?,14?,15-/m1/s1 |
| InChIKey | NTQXSKAROWFOQV-YMAMQOFZSA-N |
| XLogP | 3.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |