C24H27F3N2O5S — CID 24879720
tert-butyl (1R,9R,11S,12E)-12-ethylidene-18-(trifluoromethylsulfonyloxy)-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6,17-tetraene-8-carboxylate (PubChem CID 24879720) has the molecular formula C24H27F3N2O5S and a molecular weight of 512.55 g/mol. Its IUPAC name is tert-butyl (1R,9R,11S,12E)-12-ethylidene-18-(trifluoromethylsulfonyloxy)-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6,17-tetraene-8-carboxylate.
| Compound Name | tert-butyl (1R,9R,11S,12E)-12-ethylidene-18-(trifluoromethylsulfonyloxy)-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6,17-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 24879720 |
| Molecular Formula | C24H27F3N2O5S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | tert-butyl (1R,9R,11S,12E)-12-ethylidene-18-(trifluoromethylsulfonyloxy)-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6,17-tetraene-8-carboxylate |
| SMILES | C/C=C1/CN2CC[C@]34C=C(OS(=O)(=O)C(F)(F)F)[C@H]1C[C@]23N(C(=O)OC(C)(C)C)c1ccccc14 |
| InChI | InChI=1S/C24H27F3N2O5S/c1-5-15-14-28-11-10-22-13-19(34-35(31,32)24(25,26)27)16(15)12-23(22,28)29(20(30)33-21(2,3)4)18-9-7-6-8-17(18)22/h5-9,13,16H,10-12,14H2,1-4H3/b15-5-/t16-,22+,23+/m0/s1 |
| InChIKey | AYFBRWSCUVBNRL-JIILSGRMSA-N |
| XLogP | 4.81 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|