C10H15NO3 — CID 24879841
(3aR,4S,4aS,9aR)-4-hydroxy-3,3a,4,4a,5,6,9,9a-octahydro-2H-furo[2,3-f]indolizin-7-one (PubChem CID 24879841) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (3aR,4S,4aS,9aR)-4-hydroxy-3,3a,4,4a,5,6,9,9a-octahydro-2H-furo[2,3-f]indolizin-7-one.
| Compound Name | (3aR,4S,4aS,9aR)-4-hydroxy-3,3a,4,4a,5,6,9,9a-octahydro-2H-furo[2,3-f]indolizin-7-one |
|---|---|
| PubChem CID | 24879841 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (3aR,4S,4aS,9aR)-4-hydroxy-3,3a,4,4a,5,6,9,9a-octahydro-2H-furo[2,3-f]indolizin-7-one |
| SMILES | O=C1CC[C@H]2[C@@H](O)[C@H]3CCO[C@H]3CN12 |
| InChI | InChI=1S/C10H15NO3/c12-9-2-1-7-10(13)6-3-4-14-8(6)5-11(7)9/h6-8,10,13H,1-5H2/t6-,7-,8-,10-/m0/s1 |
| InChIKey | VFROGUHVHBNUEH-GHCJXIJMSA-N |
| XLogP | -0.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |