C10H15NO2 — CID 11367373
(3aR,4aS,9aS)-3,3a,4,4a,5,6,9,9a-octahydro-2H-furo[2,3-f]indolizin-7-one (PubChem CID 11367373) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (3aR,4aS,9aS)-3,3a,4,4a,5,6,9,9a-octahydro-2H-furo[2,3-f]indolizin-7-one.
| Compound Name | (3aR,4aS,9aS)-3,3a,4,4a,5,6,9,9a-octahydro-2H-furo[2,3-f]indolizin-7-one |
|---|---|
| PubChem CID | 11367373 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (3aR,4aS,9aS)-3,3a,4,4a,5,6,9,9a-octahydro-2H-furo[2,3-f]indolizin-7-one |
| SMILES | O=C1CC[C@H]2C[C@@H]3CCO[C@@H]3CN12 |
| InChI | InChI=1S/C10H15NO2/c12-10-2-1-8-5-7-3-4-13-9(7)6-11(8)10/h7-9H,1-6H2/t7-,8-,9+/m0/s1 |
| InChIKey | QVBPQWNVMREHJO-XHNCKOQMSA-N |
| XLogP | 0.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |