C13H21NO3 — CID 71469869
(3aS,4S,9aS,9bR)-4-ethyl-2,2-dimethyl-4,5,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-g]indolizin-7-one (PubChem CID 71469869) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (3aS,4S,9aS,9bR)-4-ethyl-2,2-dimethyl-4,5,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-g]indolizin-7-one.
| Compound Name | (3aS,4S,9aS,9bR)-4-ethyl-2,2-dimethyl-4,5,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-g]indolizin-7-one |
|---|---|
| PubChem CID | 71469869 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (3aS,4S,9aS,9bR)-4-ethyl-2,2-dimethyl-4,5,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-g]indolizin-7-one |
| SMILES | CC[C@H]1CN2C(=O)CC[C@H]2[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H21NO3/c1-4-8-7-14-9(5-6-10(14)15)12-11(8)16-13(2,3)17-12/h8-9,11-12H,4-7H2,1-3H3/t8-,9-,11-,12+/m0/s1 |
| InChIKey | PQFWYTWPMNSADM-FSZOTQKASA-N |
| XLogP | 1.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |