C16H27NO5 — CID 71469870
(2R,3R,4aS,5S,10aS,10bS)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-5,6,9,10,10a,10b-hexahydro-4aH-[1,4]dioxino[2,3-g]indolizin-8-one (PubChem CID 71469870) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is (2R,3R,4aS,5S,10aS,10bS)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-5,6,9,10,10a,10b-hexahydro-4aH-[1,4]dioxino[2,3-g]indolizin-8-one.
| Compound Name | (2R,3R,4aS,5S,10aS,10bS)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-5,6,9,10,10a,10b-hexahydro-4aH-[1,4]dioxino[2,3-g]indolizin-8-one |
|---|---|
| PubChem CID | 71469870 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | (2R,3R,4aS,5S,10aS,10bS)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-5,6,9,10,10a,10b-hexahydro-4aH-[1,4]dioxino[2,3-g]indolizin-8-one |
| SMILES | CC[C@H]1CN2C(=O)CC[C@H]2[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@@H]12 |
| InChI | InChI=1S/C16H27NO5/c1-6-10-9-17-11(7-8-12(17)18)14-13(10)21-15(2,19-4)16(3,20-5)22-14/h10-11,13-14H,6-9H2,1-5H3/t10-,11-,13-,14-,15+,16+/m0/s1 |
| InChIKey | YPBNNMOEAXTOSE-ZLUAVYQLSA-N |
| XLogP | 1.53 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |