C13H19NO4 — CID 139066716
(1R,3S,9R,12S)-14,14-dimethyl-10,13,15-trioxa-7-azatetracyclo[7.6.0.01,12.03,7]pentadecan-6-one (PubChem CID 139066716) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (1R,3S,9R,12S)-14,14-dimethyl-10,13,15-trioxa-7-azatetracyclo[7.6.0.01,12.03,7]pentadecan-6-one.
| Compound Name | (1R,3S,9R,12S)-14,14-dimethyl-10,13,15-trioxa-7-azatetracyclo[7.6.0.01,12.03,7]pentadecan-6-one |
|---|---|
| PubChem CID | 139066716 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (1R,3S,9R,12S)-14,14-dimethyl-10,13,15-trioxa-7-azatetracyclo[7.6.0.01,12.03,7]pentadecan-6-one |
| SMILES | CC1(C)O[C@H]2CO[C@@H]3CN4C(=O)CC[C@H]4C[C@]23O1 |
| InChI | InChI=1S/C13H19NO4/c1-12(2)17-10-7-16-9-6-14-8(3-4-11(14)15)5-13(9,10)18-12/h8-10H,3-7H2,1-2H3/t8-,9+,10-,13+/m0/s1 |
| InChIKey | YGNNJRDLEQWLPZ-MPXOCVNLSA-N |
| XLogP | 0.67 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |