About 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one
5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one (PubChem CID 24879848) has the molecular formula C7H7Cl3O2
and a molecular weight of 229.49 g/mol. Its IUPAC name is 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one |
| PubChem CID | 24879848 |
| Molecular Formula | C7H7Cl3O2 |
| Molecular Weight | 229.49 g/mol |
| Exact Mass | 227.95 |
| IUPAC Name | 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one |
| SMILES | CC1=CCC(C(Cl)(Cl)Cl)OC1=O |
| InChI | InChI=1S/C7H7Cl3O2/c1-4-2-3-5(7(8,9)10)12-6(4)11/h2,5H,3H2,1H3 |
| InChIKey | PARVVBDLOVKFCZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one?
The IUPAC name of 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one (CID 24879848) is 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one.
What is the SMILES notation for 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one?
The canonical SMILES for 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one is CC1=CCC(C(Cl)(Cl)Cl)OC1=O.
What is the InChIKey of 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one?
The InChIKey is PARVVBDLOVKFCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl3O2/c1-4-2-3-5(7(8,9)10)12-6(4)11/h2,5H,3H2,1H3.
What are the key properties of 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one?
5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one has a molecular weight of 229.49 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(trichloromethyl)-2,3-dihydropyran-6-one is sourced from PubChem (CID 24879848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).