C20H23NO3Si — CID 24879940
3-[(3S)-3-[dimethyl(phenyl)silyl]-3-phenylpropanoyl]-1,3-oxazolidin-2-one (PubChem CID 24879940) has the molecular formula C20H23NO3Si and a molecular weight of 353.49 g/mol. Its IUPAC name is 3-[(3S)-3-[dimethyl(phenyl)silyl]-3-phenylpropanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3S)-3-[dimethyl(phenyl)silyl]-3-phenylpropanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 24879940 |
| Molecular Formula | C20H23NO3Si |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-[(3S)-3-[dimethyl(phenyl)silyl]-3-phenylpropanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(c1ccccc1)[C@@H](CC(=O)N1CCOC1=O)c1ccccc1 |
| InChI | InChI=1S/C20H23NO3Si/c1-25(2,17-11-7-4-8-12-17)18(16-9-5-3-6-10-16)15-19(22)21-13-14-24-20(21)23/h3-12,18H,13-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | ZNAOXVHSPVBEJV-SFHVURJKSA-N |
| XLogP | 3.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|