C21H17Cl2F3N6S — CID 24882876
2-N-(2,6-dichlorophenyl)-5-N-propan-2-yl-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine (PubChem CID 24882876) has the molecular formula C21H17Cl2F3N6S and a molecular weight of 513.38 g/mol. Its IUPAC name is 2-N-(2,6-dichlorophenyl)-5-N-propan-2-yl-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine.
| Compound Name | 2-N-(2,6-dichlorophenyl)-5-N-propan-2-yl-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine |
|---|---|
| PubChem CID | 24882876 |
| Molecular Formula | C21H17Cl2F3N6S |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 2-N-(2,6-dichlorophenyl)-5-N-propan-2-yl-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine |
| SMILES | CC(C)Nc1nc(Nc2ccc(C(F)(F)F)cc2)c2nc(Nc3c(Cl)cccc3Cl)sc2n1 |
| InChI | InChI=1S/C21H17Cl2F3N6S/c1-10(2)27-19-31-17(28-12-8-6-11(7-9-12)21(24,25)26)16-18(32-19)33-20(30-16)29-15-13(22)4-3-5-14(15)23/h3-10H,1-2H3,(H,29,30)(H2,27,28,31,32) |
| InChIKey | FFBBIJYCAUUUNB-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |