C42H66O4 — CID 24883683
[(4S,6R,9S)-14-[(1R)-2-hydroxy-1-[(4R,9R)-5,5,9-trimethyl-14-tetracyclo[11.2.1.01,10.04,9]hexadec-14-enyl]ethoxy]-5,5,9-trimethyl-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 24883683) has the molecular formula C42H66O4 and a molecular weight of 634.99 g/mol. Its IUPAC name is [(4S,6R,9S)-14-[(1R)-2-hydroxy-1-[(4R,9R)-5,5,9-trimethyl-14-tetracyclo[11.2.1.01,10.04,9]hexadec-14-enyl]ethoxy]-5,5,9-trimethyl-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(4S,6R,9S)-14-[(1R)-2-hydroxy-1-[(4R,9R)-5,5,9-trimethyl-14-tetracyclo[11.2.1.01,10.04,9]hexadec-14-enyl]ethoxy]-5,5,9-trimethyl-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 24883683 |
| Molecular Formula | C42H66O4 |
| Molecular Weight | 634.99 g/mol |
| Exact Mass | 634.50 |
| IUPAC Name | [(4S,6R,9S)-14-[(1R)-2-hydroxy-1-[(4R,9R)-5,5,9-trimethyl-14-tetracyclo[11.2.1.01,10.04,9]hexadec-14-enyl]ethoxy]-5,5,9-trimethyl-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)C3CCC4CC3(CC[C@@H]2C1(C)C)CC4O[C@@H](CO)C1=CC23CC[C@@H]4C(C)(C)CCC[C@@]4(C)C2CCC1C3 |
| InChI | InChI=1S/C42H66O4/c1-26(44)45-36-15-18-40(7)33(38(36,4)5)14-20-42-22-28(10-12-35(40)42)30(24-42)46-31(25-43)29-23-41-19-13-32-37(2,3)16-8-17-39(32,6)34(41)11-9-27(29)21-41/h23,27-28,30-36,43H,8-22,24-25H2,1-7H3/t27?,28?,30?,31-,32+,33+,34?,35?,36+,39+,40+,41?,42?/m0/s1 |
| InChIKey | KXZSWFXOEVKIOH-SDYBPNCKSA-N |
| XLogP | 9.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.99 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|