C27H40O5 — CID 163113432
[8-acetyl-4a-(hydroxymethyl)-1,1,6a,10b-tetramethyl-9-oxo-3,4,4b,5,6,10,10a,11,12,12a-decahydro-2H-chrysen-6-yl] acetate (PubChem CID 163113432) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is [8-acetyl-4a-(hydroxymethyl)-1,1,6a,10b-tetramethyl-9-oxo-3,4,4b,5,6,10,10a,11,12,12a-decahydro-2H-chrysen-6-yl] acetate.
| Compound Name | [8-acetyl-4a-(hydroxymethyl)-1,1,6a,10b-tetramethyl-9-oxo-3,4,4b,5,6,10,10a,11,12,12a-decahydro-2H-chrysen-6-yl] acetate |
|---|---|
| PubChem CID | 163113432 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | [8-acetyl-4a-(hydroxymethyl)-1,1,6a,10b-tetramethyl-9-oxo-3,4,4b,5,6,10,10a,11,12,12a-decahydro-2H-chrysen-6-yl] acetate |
| SMILES | CC(=O)OC1CC2C(C)(CCC3C(C)(C)CCCC32CO)C2CC(=O)C(C(C)=O)=CC12C |
| InChI | InChI=1S/C27H40O5/c1-16(29)18-14-26(6)21(12-19(18)31)25(5)11-8-20-24(3,4)9-7-10-27(20,15-28)22(25)13-23(26)32-17(2)30/h14,20-23,28H,7-13,15H2,1-6H3 |
| InChIKey | SEQDXXRKGOIMDC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|