C12H11N3 — CID 24884001
1-(cyclopenta-2,4-dien-1-ylmethyl)benzotriazole (PubChem CID 24884001) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-(cyclopenta-2,4-dien-1-ylmethyl)benzotriazole.
| Compound Name | 1-(cyclopenta-2,4-dien-1-ylmethyl)benzotriazole |
|---|---|
| PubChem CID | 24884001 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-(cyclopenta-2,4-dien-1-ylmethyl)benzotriazole |
| SMILES | C1=CC(Cn2nnc3ccccc32)C=C1 |
| InChI | InChI=1S/C12H11N3/c1-2-6-10(5-1)9-15-12-8-4-3-7-11(12)13-14-15/h1-8,10H,9H2 |
| InChIKey | IWKAIELUGNSAHE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |