About sodium N-butylsulfamate
sodium N-butylsulfamate (PubChem CID 24885538) has the molecular formula C4H10NNaO3S
and a molecular weight of 175.18 g/mol. Its IUPAC name is sodium N-butylsulfamate.
Molecular Properties
| Compound Name | sodium N-butylsulfamate |
| PubChem CID | 24885538 |
| Molecular Formula | C4H10NNaO3S |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | sodium N-butylsulfamate |
| SMILES | CCCCNS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H11NO3S.Na/c1-2-3-4-5-9(6,7)8;/h5H,2-4H2,1H3,(H,6,7,8);/q;+1/p-1 |
| InChIKey | XFNVBZPKQCXQHY-UHFFFAOYSA-M |
| XLogP | -3.16 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium N-butylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-butylsulfamate?
The IUPAC name of sodium N-butylsulfamate (CID 24885538) is sodium N-butylsulfamate.
What is the SMILES notation for sodium N-butylsulfamate?
The canonical SMILES for sodium N-butylsulfamate is CCCCNS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium N-butylsulfamate?
The InChIKey is XFNVBZPKQCXQHY-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H11NO3S.Na/c1-2-3-4-5-9(6,7)8;/h5H,2-4H2,1H3,(H,6,7,8);/q;+1/p-1.
What are the key properties of sodium N-butylsulfamate?
sodium N-butylsulfamate has a molecular weight of 175.18 g/mol, XLogP of -3.16, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-butylsulfamate is sourced from PubChem (CID 24885538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).