C14H15N3O4 — CID 24888678
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 24888678) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24888678 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(C)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C14H15N3O4/c1-14(12(19)15-13(20)16-14)7-17-6-8-3-4-9(21-2)5-10(8)11(17)18/h3-5H,6-7H2,1-2H3,(H2,15,16,19,20) |
| InChIKey | BMHLDTHLHCGSBB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|