C57H86O6 — CID 24891282
2,3-di(octadeca-8,10-diynoyloxy)propyl octadeca-8,10-diynoate (PubChem CID 24891282) has the molecular formula C57H86O6 and a molecular weight of 867.31 g/mol. Its IUPAC name is 2,3-di(octadeca-8,10-diynoyloxy)propyl octadeca-8,10-diynoate.
| Compound Name | 2,3-di(octadeca-8,10-diynoyloxy)propyl octadeca-8,10-diynoate |
|---|---|
| PubChem CID | 24891282 |
| Molecular Formula | C57H86O6 |
| Molecular Weight | 867.31 g/mol |
| Exact Mass | 866.64 |
| IUPAC Name | 2,3-di(octadeca-8,10-diynoyloxy)propyl octadeca-8,10-diynoate |
| SMILES | CCCCCCCC#CC#CCCCCCCC(=O)OCC(COC(=O)CCCCCCC#CC#CCCCCCCC)OC(=O)CCCCCCC#CC#CCCCCCCC |
| InChI | InChI=1S/C57H86O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h54H,4-21,34-53H2,1-3H3 |
| InChIKey | YRWFNIHEDZKZJW-UHFFFAOYSA-N |
| XLogP | 14.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.31 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|