C51H74O6 — CID 91523077
2,3-di(hexadeca-7,9-diynoyloxy)propyl hexadeca-7,9-diynoate (PubChem CID 91523077) has the molecular formula C51H74O6 and a molecular weight of 783.15 g/mol. Its IUPAC name is 2,3-di(hexadeca-7,9-diynoyloxy)propyl hexadeca-7,9-diynoate.
| Compound Name | 2,3-di(hexadeca-7,9-diynoyloxy)propyl hexadeca-7,9-diynoate |
|---|---|
| PubChem CID | 91523077 |
| Molecular Formula | C51H74O6 |
| Molecular Weight | 783.15 g/mol |
| Exact Mass | 782.55 |
| IUPAC Name | 2,3-di(hexadeca-7,9-diynoyloxy)propyl hexadeca-7,9-diynoate |
| SMILES | CCCCCCC#CC#CCCCCCC(=O)OCC(COC(=O)CCCCCC#CC#CCCCCCC)OC(=O)CCCCCC#CC#CCCCCCC |
| InChI | InChI=1S/C51H74O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-49(52)55-46-48(57-51(54)45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)47-56-50(53)44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h48H,4-18,31-47H2,1-3H3 |
| InChIKey | JBCLQXITDPZTAD-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.15 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|