C27H28F3N3O3 — CID 24892525
N-butyl-2-[3-(4-methoxyphenyl)phenyl]-6-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 24892525) has the molecular formula C27H28F3N3O3 and a molecular weight of 499.53 g/mol. Its IUPAC name is N-butyl-2-[3-(4-methoxyphenyl)phenyl]-6-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-2-[3-(4-methoxyphenyl)phenyl]-6-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24892525 |
| Molecular Formula | C27H28F3N3O3 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-butyl-2-[3-(4-methoxyphenyl)phenyl]-6-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNc1c(-c2cccc(-c3ccc(OC)cc3)c2)nc2ccc(C)cn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H27N3O.C2HF3O2/c1-4-5-15-26-25-24(27-23-14-9-18(2)17-28(23)25)21-8-6-7-20(16-21)19-10-12-22(29-3)13-11-19;3-2(4,5)1(6)7/h6-14,16-17,26H,4-5,15H2,1-3H3;(H,6,7) |
| InChIKey | VGBUSRVDVNWUQF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|