C34H54O5 — CID 24893830
2-[(14R,16R)-3-acetyloxy-16-hydroxy-4,4,10,12,13,14-hexamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5,6-dimethylhept-6-enoic acid (PubChem CID 24893830) has the molecular formula C34H54O5 and a molecular weight of 542.80 g/mol. Its IUPAC name is 2-[(14R,16R)-3-acetyloxy-16-hydroxy-4,4,10,12,13,14-hexamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5,6-dimethylhept-6-enoic acid.
| Compound Name | 2-[(14R,16R)-3-acetyloxy-16-hydroxy-4,4,10,12,13,14-hexamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5,6-dimethylhept-6-enoic acid |
|---|---|
| PubChem CID | 24893830 |
| Molecular Formula | C34H54O5 |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.40 |
| IUPAC Name | 2-[(14R,16R)-3-acetyloxy-16-hydroxy-4,4,10,12,13,14-hexamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5,6-dimethylhept-6-enoic acid |
| SMILES | C=C(C)C(C)CCC(C(=O)O)C1[C@H](O)C[C@@]2(C)C3=C(CC(C)C12C)C1(C)CCC(OC(C)=O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C34H54O5/c1-19(2)20(3)11-12-23(30(37)38)29-26(36)18-33(9)24-13-14-27-31(6,7)28(39-22(5)35)15-16-32(27,8)25(24)17-21(4)34(29,33)10/h20-21,23,26-29,36H,1,11-18H2,2-10H3,(H,37,38)/t20?,21?,23?,26-,27?,28?,29?,32?,33+,34?/m1/s1 |
| InChIKey | YOXIHTBMJYKGCK-TUENUYMJSA-N |
| XLogP | 7.58 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|