C27H33N3O3 — CID 24895047
(2R)-2-[5-[[2-(1-adamantyl)acetyl]amino]-1-oxoisoquinolin-2-yl]-N-cyclopropylpropanamide (PubChem CID 24895047) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is (2R)-2-[5-[[2-(1-adamantyl)acetyl]amino]-1-oxoisoquinolin-2-yl]-N-cyclopropylpropanamide.
| Compound Name | (2R)-2-[5-[[2-(1-adamantyl)acetyl]amino]-1-oxoisoquinolin-2-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 24895047 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | (2R)-2-[5-[[2-(1-adamantyl)acetyl]amino]-1-oxoisoquinolin-2-yl]-N-cyclopropylpropanamide |
| SMILES | C[C@H](C(=O)NC1CC1)n1ccc2c(NC(=O)CC34CC5CC(CC(C5)C3)C4)cccc2c1=O |
| InChI | InChI=1S/C27H33N3O3/c1-16(25(32)28-20-5-6-20)30-8-7-21-22(26(30)33)3-2-4-23(21)29-24(31)15-27-12-17-9-18(13-27)11-19(10-17)14-27/h2-4,7-8,16-20H,5-6,9-15H2,1H3,(H,28,32)(H,29,31)/t16-,17?,18?,19?,27?/m1/s1 |
| InChIKey | ZXRZMTKRMFRXCJ-UYTITELCSA-N |
| XLogP | 4.39 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |