C30H39N3O3 — CID 69270959
2-[5-[[2-(1-adamantyl)acetyl]amino]-1-oxoisoquinolin-2-yl]-3-cyclohexylpropanamide (PubChem CID 69270959) has the molecular formula C30H39N3O3 and a molecular weight of 489.66 g/mol. Its IUPAC name is 2-[5-[[2-(1-adamantyl)acetyl]amino]-1-oxoisoquinolin-2-yl]-3-cyclohexylpropanamide.
| Compound Name | 2-[5-[[2-(1-adamantyl)acetyl]amino]-1-oxoisoquinolin-2-yl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 69270959 |
| Molecular Formula | C30H39N3O3 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | 2-[5-[[2-(1-adamantyl)acetyl]amino]-1-oxoisoquinolin-2-yl]-3-cyclohexylpropanamide |
| SMILES | NC(=O)C(CC1CCCCC1)n1ccc2c(NC(=O)CC34CC5CC(CC(C5)C3)C4)cccc2c1=O |
| InChI | InChI=1S/C30H39N3O3/c31-28(35)26(14-19-5-2-1-3-6-19)33-10-9-23-24(29(33)36)7-4-8-25(23)32-27(34)18-30-15-20-11-21(16-30)13-22(12-20)17-30/h4,7-10,19-22,26H,1-3,5-6,11-18H2,(H2,31,35)(H,32,34) |
| InChIKey | VKOLDMVTJMKQHF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |