C19H31Cl3N2O — CID 24895127
1-[1-(3-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]cyclohexan-1-ol;dihydrochloride (PubChem CID 24895127) has the molecular formula C19H31Cl3N2O and a molecular weight of 409.83 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]cyclohexan-1-ol;dihydrochloride.
| Compound Name | 1-[1-(3-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]cyclohexan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 24895127 |
| Molecular Formula | C19H31Cl3N2O |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-[1-(3-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]cyclohexan-1-ol;dihydrochloride |
| SMILES | CN1CCN(CC(c2cccc(Cl)c2)C2(O)CCCCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H29ClN2O.2ClH/c1-21-10-12-22(13-11-21)15-18(16-6-5-7-17(20)14-16)19(23)8-3-2-4-9-19;;/h5-7,14,18,23H,2-4,8-13,15H2,1H3;2*1H |
| InChIKey | KVRIVKGFVFCJEI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |