C21H22FN3O2S — CID 24896456
N-(3-fluoro-4-pentoxyphenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 24896456) has the molecular formula C21H22FN3O2S and a molecular weight of 399.49 g/mol. Its IUPAC name is N-(3-fluoro-4-pentoxyphenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-(3-fluoro-4-pentoxyphenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 24896456 |
| Molecular Formula | C21H22FN3O2S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(3-fluoro-4-pentoxyphenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCCOc1ccc(N(C(C)=O)c2nc(-c3cccnc3)cs2)cc1F |
| InChI | InChI=1S/C21H22FN3O2S/c1-3-4-5-11-27-20-9-8-17(12-18(20)22)25(15(2)26)21-24-19(14-28-21)16-7-6-10-23-13-16/h6-10,12-14H,3-5,11H2,1-2H3 |
| InChIKey | PLCXHXUDTGXVQU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|