C17H22N2O2 — CID 24897263
(1S,2R)-3-amino-1-[(3-methoxyphenyl)methylamino]-1-phenylpropan-2-ol (PubChem CID 24897263) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (1S,2R)-3-amino-1-[(3-methoxyphenyl)methylamino]-1-phenylpropan-2-ol.
| Compound Name | (1S,2R)-3-amino-1-[(3-methoxyphenyl)methylamino]-1-phenylpropan-2-ol |
|---|---|
| PubChem CID | 24897263 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1S,2R)-3-amino-1-[(3-methoxyphenyl)methylamino]-1-phenylpropan-2-ol |
| SMILES | COc1cccc(CN[C@@H](c2ccccc2)[C@H](O)CN)c1 |
| InChI | InChI=1S/C17H22N2O2/c1-21-15-9-5-6-13(10-15)12-19-17(16(20)11-18)14-7-3-2-4-8-14/h2-10,16-17,19-20H,11-12,18H2,1H3/t16-,17+/m1/s1 |
| InChIKey | HKJYZPDTQYFGSC-SJORKVTESA-N |
| XLogP | 1.85 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |