C21H14F2N2O2 — CID 24897876
8-(2,6-difluorophenyl)-4-(2-methoxyphenyl)-7-oxido-1,7-naphthyridin-7-ium (PubChem CID 24897876) has the molecular formula C21H14F2N2O2 and a molecular weight of 364.35 g/mol. Its IUPAC name is 8-(2,6-difluorophenyl)-4-(2-methoxyphenyl)-7-oxido-1,7-naphthyridin-7-ium.
| Compound Name | 8-(2,6-difluorophenyl)-4-(2-methoxyphenyl)-7-oxido-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 24897876 |
| Molecular Formula | C21H14F2N2O2 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 8-(2,6-difluorophenyl)-4-(2-methoxyphenyl)-7-oxido-1,7-naphthyridin-7-ium |
| SMILES | COc1ccccc1-c1ccnc2c(-c3c(F)cccc3F)[n+]([O-])ccc12 |
| InChI | InChI=1S/C21H14F2N2O2/c1-27-18-8-3-2-5-14(18)13-9-11-24-20-15(13)10-12-25(26)21(20)19-16(22)6-4-7-17(19)23/h2-12H,1H3 |
| InChIKey | KROWIURGYUBEKL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|