C22H16F2N2O3 — CID 24896765
4-(2,4-difluorophenyl)-8-(2,6-dimethoxyphenyl)-7-oxido-1,7-naphthyridin-7-ium (PubChem CID 24896765) has the molecular formula C22H16F2N2O3 and a molecular weight of 394.38 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-8-(2,6-dimethoxyphenyl)-7-oxido-1,7-naphthyridin-7-ium.
| Compound Name | 4-(2,4-difluorophenyl)-8-(2,6-dimethoxyphenyl)-7-oxido-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 24896765 |
| Molecular Formula | C22H16F2N2O3 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 4-(2,4-difluorophenyl)-8-(2,6-dimethoxyphenyl)-7-oxido-1,7-naphthyridin-7-ium |
| SMILES | COc1cccc(OC)c1-c1c2nccc(-c3ccc(F)cc3F)c2cc[n+]1[O-] |
| InChI | InChI=1S/C22H16F2N2O3/c1-28-18-4-3-5-19(29-2)20(18)22-21-16(9-11-26(22)27)14(8-10-25-21)15-7-6-13(23)12-17(15)24/h3-12H,1-2H3 |
| InChIKey | XWAAUXLCOGNSMI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|