C21H25ClN2O3S — CID 24899698
5-chloro-2-methoxy-N-[3-(oxan-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 24899698) has the molecular formula C21H25ClN2O3S and a molecular weight of 420.96 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[3-(oxan-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[3-(oxan-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 24899698 |
| Molecular Formula | C21H25ClN2O3S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 5-chloro-2-methoxy-N-[3-(oxan-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)/N=c1\sc2c(n1CC1CCOCC1)CCCC2 |
| InChI | InChI=1S/C21H25ClN2O3S/c1-26-18-7-6-15(22)12-16(18)20(25)23-21-24(13-14-8-10-27-11-9-14)17-4-2-3-5-19(17)28-21/h6-7,12,14H,2-5,8-11,13H2,1H3/b23-21- |
| InChIKey | WJSAXPGXOJWVKS-LNVKXUELSA-N |
| XLogP | 4.26 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|