C18H20N2O — CID 24901460
(3Z)-3-(2-phenylethoxyimino)-2,4-dihydro-1H-naphthalen-2-amine (PubChem CID 24901460) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is (3Z)-3-(2-phenylethoxyimino)-2,4-dihydro-1H-naphthalen-2-amine.
| Compound Name | (3Z)-3-(2-phenylethoxyimino)-2,4-dihydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 24901460 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (3Z)-3-(2-phenylethoxyimino)-2,4-dihydro-1H-naphthalen-2-amine |
| SMILES | NC1Cc2ccccc2C/C1=N/OCCc1ccccc1 |
| InChI | InChI=1S/C18H20N2O/c19-17-12-15-8-4-5-9-16(15)13-18(17)20-21-11-10-14-6-2-1-3-7-14/h1-9,17H,10-13,19H2/b20-18- |
| InChIKey | IKDOORIXCLPFIO-ZZEZOPTASA-N |
| XLogP | 2.73 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|