C19H22N2O4 — CID 24901605
methyl (2S)-2-amino-5-oxo-5-(4-phenylmethoxyanilino)pentanoate (PubChem CID 24901605) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-oxo-5-(4-phenylmethoxyanilino)pentanoate.
| Compound Name | methyl (2S)-2-amino-5-oxo-5-(4-phenylmethoxyanilino)pentanoate |
|---|---|
| PubChem CID | 24901605 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | methyl (2S)-2-amino-5-oxo-5-(4-phenylmethoxyanilino)pentanoate |
| SMILES | COC(=O)[C@@H](N)CCC(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-24-19(23)17(20)11-12-18(22)21-15-7-9-16(10-8-15)25-13-14-5-3-2-4-6-14/h2-10,17H,11-13,20H2,1H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | IBGCEAJBKNAHSX-KRWDZBQOSA-N |
| XLogP | 2.48 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |