C22H28N2O4 — CID 24901606
tert-butyl (2S)-2-amino-5-oxo-5-(4-phenylmethoxyanilino)pentanoate (PubChem CID 24901606) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-5-oxo-5-(4-phenylmethoxyanilino)pentanoate.
| Compound Name | tert-butyl (2S)-2-amino-5-oxo-5-(4-phenylmethoxyanilino)pentanoate |
|---|---|
| PubChem CID | 24901606 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | tert-butyl (2S)-2-amino-5-oxo-5-(4-phenylmethoxyanilino)pentanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N)CCC(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-22(2,3)28-21(26)19(23)13-14-20(25)24-17-9-11-18(12-10-17)27-15-16-7-5-4-6-8-16/h4-12,19H,13-15,23H2,1-3H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | HPXZNBKBSKPEKV-IBGZPJMESA-N |
| XLogP | 3.65 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |