C25H17FN4O3 — CID 24901689
N-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)phenyl]-1-oxido-6-phenylpyridin-1-ium-2-carboxamide (PubChem CID 24901689) has the molecular formula C25H17FN4O3 and a molecular weight of 440.43 g/mol. Its IUPAC name is N-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)phenyl]-1-oxido-6-phenylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)phenyl]-1-oxido-6-phenylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 24901689 |
| Molecular Formula | C25H17FN4O3 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)phenyl]-1-oxido-6-phenylpyridin-1-ium-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccnc3[nH]ccc23)c(F)c1)c1cccc(-c2ccccc2)[n+]1[O-] |
| InChI | InChI=1S/C25H17FN4O3/c26-19-15-17(9-10-23(19)33-22-12-14-28-24-18(22)11-13-27-24)29-25(31)21-8-4-7-20(30(21)32)16-5-2-1-3-6-16/h1-15H,(H,27,28)(H,29,31) |
| InChIKey | QDVLUPLLJVFWGU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|