C22H26ClF3N2O — CID 24905415
N'-[4-(3-tert-butyl-4-chlorophenoxy)-2-methyl-5-(trifluoromethyl)phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 24905415) has the molecular formula C22H26ClF3N2O and a molecular weight of 426.91 g/mol. Its IUPAC name is N'-[4-(3-tert-butyl-4-chlorophenoxy)-2-methyl-5-(trifluoromethyl)phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-(3-tert-butyl-4-chlorophenoxy)-2-methyl-5-(trifluoromethyl)phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 24905415 |
| Molecular Formula | C22H26ClF3N2O |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N'-[4-(3-tert-butyl-4-chlorophenoxy)-2-methyl-5-(trifluoromethyl)phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C(F)(F)F)c(Oc2ccc(Cl)c(C(C)(C)C)c2)cc1C |
| InChI | InChI=1S/C22H26ClF3N2O/c1-7-28(6)13-27-19-12-17(22(24,25)26)20(10-14(19)2)29-15-8-9-18(23)16(11-15)21(3,4)5/h8-13H,7H2,1-6H3/b27-13+ |
| InChIKey | IBBKYECIOZKJAQ-UVHMKAGCSA-N |
| XLogP | 7.37 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|